About 5-bromo-N,4,6-trimethylpyrimidin-2-amine
5-bromo-N,4,6-trimethylpyrimidin-2-amine (PubChem CID 130009212) has the molecular formula C7H10BrN3
and a molecular weight of 216.08 g/mol. Its IUPAC name is 5-bromo-N,4,6-trimethylpyrimidin-2-amine.
Molecular Properties
| Compound Name | 5-bromo-N,4,6-trimethylpyrimidin-2-amine |
| PubChem CID | 130009212 |
| Molecular Formula | C7H10BrN3 |
| Molecular Weight | 216.08 g/mol |
| Exact Mass | 215.01 |
| IUPAC Name | 5-bromo-N,4,6-trimethylpyrimidin-2-amine |
| SMILES | CNc1nc(C)c(Br)c(C)n1 |
| InChI | InChI=1S/C7H10BrN3/c1-4-6(8)5(2)11-7(9-3)10-4/h1-3H3,(H,9,10,11) |
| InChIKey | XHQRJRKXUOWHLG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.08 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-N,4,6-trimethylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N,4,6-trimethylpyrimidin-2-amine?
The IUPAC name of 5-bromo-N,4,6-trimethylpyrimidin-2-amine (CID 130009212) is 5-bromo-N,4,6-trimethylpyrimidin-2-amine.
What is the SMILES notation for 5-bromo-N,4,6-trimethylpyrimidin-2-amine?
The canonical SMILES for 5-bromo-N,4,6-trimethylpyrimidin-2-amine is CNc1nc(C)c(Br)c(C)n1.
What is the InChIKey of 5-bromo-N,4,6-trimethylpyrimidin-2-amine?
The InChIKey is XHQRJRKXUOWHLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10BrN3/c1-4-6(8)5(2)11-7(9-3)10-4/h1-3H3,(H,9,10,11).
What are the key properties of 5-bromo-N,4,6-trimethylpyrimidin-2-amine?
5-bromo-N,4,6-trimethylpyrimidin-2-amine has a molecular weight of 216.08 g/mol, XLogP of 1.90, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N,4,6-trimethylpyrimidin-2-amine is sourced from PubChem (CID 130009212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).