C7H8N4S2 — CID 130009307
6,9-dimethyl-1,7-dihydropurine-2,8-dithione (PubChem CID 130009307) has the molecular formula C7H8N4S2 and a molecular weight of 212.30 g/mol. Its IUPAC name is 6,9-dimethyl-1,7-dihydropurine-2,8-dithione.
| Compound Name | 6,9-dimethyl-1,7-dihydropurine-2,8-dithione |
|---|---|
| PubChem CID | 130009307 |
| Molecular Formula | C7H8N4S2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.02 |
| IUPAC Name | 6,9-dimethyl-1,7-dihydropurine-2,8-dithione |
| SMILES | Cc1[nH]c(=S)nc2c1[nH]c(=S)n2C |
| InChI | InChI=1S/C7H8N4S2/c1-3-4-5(10-6(12)8-3)11(2)7(13)9-4/h1-2H3,(H,9,13)(H,8,10,12) |
| InChIKey | LEOSHVSAYLOQEV-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 49.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|