C5H7N3O3 — CID 130009396
N,5-dimethyl-2-oxo-1,3,4-oxadiazole-3-carboxamide (PubChem CID 130009396) has the molecular formula C5H7N3O3 and a molecular weight of 157.13 g/mol. Its IUPAC name is N,5-dimethyl-2-oxo-1,3,4-oxadiazole-3-carboxamide.
| Compound Name | N,5-dimethyl-2-oxo-1,3,4-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 130009396 |
| Molecular Formula | C5H7N3O3 |
| Molecular Weight | 157.13 g/mol |
| Exact Mass | 157.05 |
| IUPAC Name | N,5-dimethyl-2-oxo-1,3,4-oxadiazole-3-carboxamide |
| SMILES | CNC(=O)n1nc(C)oc1=O |
| InChI | InChI=1S/C5H7N3O3/c1-3-7-8(4(9)6-2)5(10)11-3/h1-2H3,(H,6,9) |
| InChIKey | HFFTTXVRZDLRAJ-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.13 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |