About 5-methyl-4-sulfanylidene-1,3-thiazinan-2-one
5-methyl-4-sulfanylidene-1,3-thiazinan-2-one (PubChem CID 130009696) has the molecular formula C5H7NOS2
and a molecular weight of 161.25 g/mol. Its IUPAC name is 5-methyl-4-sulfanylidene-1,3-thiazinan-2-one.
Molecular Properties
| Compound Name | 5-methyl-4-sulfanylidene-1,3-thiazinan-2-one |
| PubChem CID | 130009696 |
| Molecular Formula | C5H7NOS2 |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.00 |
| IUPAC Name | 5-methyl-4-sulfanylidene-1,3-thiazinan-2-one |
| SMILES | CC1CSC(=O)NC1=S |
| InChI | InChI=1S/C5H7NOS2/c1-3-2-9-5(7)6-4(3)8/h3H,2H2,1H3,(H,6,7,8) |
| InChIKey | DGZKCFVJLFHALA-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-4-sulfanylidene-1,3-thiazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-4-sulfanylidene-1,3-thiazinan-2-one?
The IUPAC name of 5-methyl-4-sulfanylidene-1,3-thiazinan-2-one (CID 130009696) is 5-methyl-4-sulfanylidene-1,3-thiazinan-2-one.
What is the SMILES notation for 5-methyl-4-sulfanylidene-1,3-thiazinan-2-one?
The canonical SMILES for 5-methyl-4-sulfanylidene-1,3-thiazinan-2-one is CC1CSC(=O)NC1=S.
What is the InChIKey of 5-methyl-4-sulfanylidene-1,3-thiazinan-2-one?
The InChIKey is DGZKCFVJLFHALA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NOS2/c1-3-2-9-5(7)6-4(3)8/h3H,2H2,1H3,(H,6,7,8).
What are the key properties of 5-methyl-4-sulfanylidene-1,3-thiazinan-2-one?
5-methyl-4-sulfanylidene-1,3-thiazinan-2-one has a molecular weight of 161.25 g/mol, XLogP of 1.41, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-4-sulfanylidene-1,3-thiazinan-2-one is sourced from PubChem (CID 130009696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).