About (5-methyl-1,2-thiazol-3-yl) N-methylcarbamate
(5-methyl-1,2-thiazol-3-yl) N-methylcarbamate (PubChem CID 130009719) has the molecular formula C6H8N2O2S
and a molecular weight of 172.21 g/mol. Its IUPAC name is (5-methyl-1,2-thiazol-3-yl) N-methylcarbamate.
Molecular Properties
| Compound Name | (5-methyl-1,2-thiazol-3-yl) N-methylcarbamate |
| PubChem CID | 130009719 |
| Molecular Formula | C6H8N2O2S |
| Molecular Weight | 172.21 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | (5-methyl-1,2-thiazol-3-yl) N-methylcarbamate |
| SMILES | CNC(=O)Oc1cc(C)sn1 |
| InChI | InChI=1S/C6H8N2O2S/c1-4-3-5(8-11-4)10-6(9)7-2/h3H,1-2H3,(H,7,9) |
| InChIKey | OQCQHYBCZIAUJG-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.21 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-methyl-1,2-thiazol-3-yl) N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-1,2-thiazol-3-yl) N-methylcarbamate?
The IUPAC name of (5-methyl-1,2-thiazol-3-yl) N-methylcarbamate (CID 130009719) is (5-methyl-1,2-thiazol-3-yl) N-methylcarbamate.
What is the SMILES notation for (5-methyl-1,2-thiazol-3-yl) N-methylcarbamate?
The canonical SMILES for (5-methyl-1,2-thiazol-3-yl) N-methylcarbamate is CNC(=O)Oc1cc(C)sn1.
What is the InChIKey of (5-methyl-1,2-thiazol-3-yl) N-methylcarbamate?
The InChIKey is OQCQHYBCZIAUJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2S/c1-4-3-5(8-11-4)10-6(9)7-2/h3H,1-2H3,(H,7,9).
What are the key properties of (5-methyl-1,2-thiazol-3-yl) N-methylcarbamate?
(5-methyl-1,2-thiazol-3-yl) N-methylcarbamate has a molecular weight of 172.21 g/mol, XLogP of 1.17, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-1,2-thiazol-3-yl) N-methylcarbamate is sourced from PubChem (CID 130009719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).