About 2-hydroxy-N,N'-dimethylbutanediamide
2-hydroxy-N,N'-dimethylbutanediamide (PubChem CID 130010779) has the molecular formula C6H12N2O3
and a molecular weight of 160.17 g/mol. Its IUPAC name is 2-hydroxy-N,N'-dimethylbutanediamide.
Molecular Properties
| Compound Name | 2-hydroxy-N,N'-dimethylbutanediamide |
| PubChem CID | 130010779 |
| Molecular Formula | C6H12N2O3 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.08 |
| IUPAC Name | 2-hydroxy-N,N'-dimethylbutanediamide |
| SMILES | CNC(=O)CC(O)C(=O)NC |
| InChI | InChI=1S/C6H12N2O3/c1-7-5(10)3-4(9)6(11)8-2/h4,9H,3H2,1-2H3,(H,7,10)(H,8,11) |
| InChIKey | LVQOIISVZOUORD-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-hydroxy-N,N'-dimethylbutanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-N,N'-dimethylbutanediamide?
The IUPAC name of 2-hydroxy-N,N'-dimethylbutanediamide (CID 130010779) is 2-hydroxy-N,N'-dimethylbutanediamide.
What is the SMILES notation for 2-hydroxy-N,N'-dimethylbutanediamide?
The canonical SMILES for 2-hydroxy-N,N'-dimethylbutanediamide is CNC(=O)CC(O)C(=O)NC.
What is the InChIKey of 2-hydroxy-N,N'-dimethylbutanediamide?
The InChIKey is LVQOIISVZOUORD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O3/c1-7-5(10)3-4(9)6(11)8-2/h4,9H,3H2,1-2H3,(H,7,10)(H,8,11).
What are the key properties of 2-hydroxy-N,N'-dimethylbutanediamide?
2-hydroxy-N,N'-dimethylbutanediamide has a molecular weight of 160.17 g/mol, XLogP of -1.77, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-N,N'-dimethylbutanediamide is sourced from PubChem (CID 130010779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).