About 1-(tert-butylcarbamoyl)-1,3-dimethylurea
1-(tert-butylcarbamoyl)-1,3-dimethylurea (PubChem CID 130010985) has the molecular formula C8H17N3O2
and a molecular weight of 187.24 g/mol. Its IUPAC name is 1-(tert-butylcarbamoyl)-1,3-dimethylurea.
Molecular Properties
| Compound Name | 1-(tert-butylcarbamoyl)-1,3-dimethylurea |
| PubChem CID | 130010985 |
| Molecular Formula | C8H17N3O2 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.13 |
| IUPAC Name | 1-(tert-butylcarbamoyl)-1,3-dimethylurea |
| SMILES | CNC(=O)N(C)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C8H17N3O2/c1-8(2,3)10-7(13)11(5)6(12)9-4/h1-5H3,(H,9,12)(H,10,13) |
| InChIKey | KAWOVPHAYCQWIB-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(tert-butylcarbamoyl)-1,3-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(tert-butylcarbamoyl)-1,3-dimethylurea?
The IUPAC name of 1-(tert-butylcarbamoyl)-1,3-dimethylurea (CID 130010985) is 1-(tert-butylcarbamoyl)-1,3-dimethylurea.
What is the SMILES notation for 1-(tert-butylcarbamoyl)-1,3-dimethylurea?
The canonical SMILES for 1-(tert-butylcarbamoyl)-1,3-dimethylurea is CNC(=O)N(C)C(=O)NC(C)(C)C.
What is the InChIKey of 1-(tert-butylcarbamoyl)-1,3-dimethylurea?
The InChIKey is KAWOVPHAYCQWIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N3O2/c1-8(2,3)10-7(13)11(5)6(12)9-4/h1-5H3,(H,9,12)(H,10,13).
What are the key properties of 1-(tert-butylcarbamoyl)-1,3-dimethylurea?
1-(tert-butylcarbamoyl)-1,3-dimethylurea has a molecular weight of 187.24 g/mol, XLogP of 0.77, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(tert-butylcarbamoyl)-1,3-dimethylurea is sourced from PubChem (CID 130010985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).