C10H11NO3 — CID 130011564
N-(2,5-dimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)acetamide (PubChem CID 130011564) has the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. Its IUPAC name is N-(2,5-dimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)acetamide.
| Compound Name | N-(2,5-dimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)acetamide |
|---|---|
| PubChem CID | 130011564 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | N-(2,5-dimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)acetamide |
| SMILES | CC(=O)NC1=C(C)C(=O)C=C(C)C1=O |
| InChI | InChI=1S/C10H11NO3/c1-5-4-8(13)6(2)9(10(5)14)11-7(3)12/h4H,1-3H3,(H,11,12) |
| InChIKey | DCZPBLXTAIMKOQ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|