C6H7N3O3 — CID 13001214
6-(2-oxopropyl)-2H-1,2,4-triazine-3,5-dione (PubChem CID 13001214) has the molecular formula C6H7N3O3 and a molecular weight of 169.14 g/mol. Its IUPAC name is 6-(2-oxopropyl)-2H-1,2,4-triazine-3,5-dione.
| Compound Name | 6-(2-oxopropyl)-2H-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 13001214 |
| Molecular Formula | C6H7N3O3 |
| Molecular Weight | 169.14 g/mol |
| Exact Mass | 169.05 |
| IUPAC Name | 6-(2-oxopropyl)-2H-1,2,4-triazine-3,5-dione |
| SMILES | CC(=O)Cc1n[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C6H7N3O3/c1-3(10)2-4-5(11)7-6(12)9-8-4/h2H2,1H3,(H2,7,9,11,12) |
| InChIKey | PGDTYRQSCLVWRC-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 95.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.14 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |