About 4-chloro-5-phenoxy-1,3-oxazolidin-2-one
4-chloro-5-phenoxy-1,3-oxazolidin-2-one (PubChem CID 130012311) has the molecular formula C9H8ClNO3
and a molecular weight of 213.62 g/mol. Its IUPAC name is 4-chloro-5-phenoxy-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 4-chloro-5-phenoxy-1,3-oxazolidin-2-one |
| PubChem CID | 130012311 |
| Molecular Formula | C9H8ClNO3 |
| Molecular Weight | 213.62 g/mol |
| Exact Mass | 213.02 |
| IUPAC Name | 4-chloro-5-phenoxy-1,3-oxazolidin-2-one |
| SMILES | O=C1NC(Cl)C(Oc2ccccc2)O1 |
| InChI | InChI=1S/C9H8ClNO3/c10-7-8(14-9(12)11-7)13-6-4-2-1-3-5-6/h1-5,7-8H,(H,11,12) |
| InChIKey | DZAABULIWMWPOT-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.62 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-5-phenoxy-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-5-phenoxy-1,3-oxazolidin-2-one?
The IUPAC name of 4-chloro-5-phenoxy-1,3-oxazolidin-2-one (CID 130012311) is 4-chloro-5-phenoxy-1,3-oxazolidin-2-one.
What is the SMILES notation for 4-chloro-5-phenoxy-1,3-oxazolidin-2-one?
The canonical SMILES for 4-chloro-5-phenoxy-1,3-oxazolidin-2-one is O=C1NC(Cl)C(Oc2ccccc2)O1.
What is the InChIKey of 4-chloro-5-phenoxy-1,3-oxazolidin-2-one?
The InChIKey is DZAABULIWMWPOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClNO3/c10-7-8(14-9(12)11-7)13-6-4-2-1-3-5-6/h1-5,7-8H,(H,11,12).
What are the key properties of 4-chloro-5-phenoxy-1,3-oxazolidin-2-one?
4-chloro-5-phenoxy-1,3-oxazolidin-2-one has a molecular weight of 213.62 g/mol, XLogP of 1.70, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-5-phenoxy-1,3-oxazolidin-2-one is sourced from PubChem (CID 130012311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).