C10H11NO3 — CID 130012547
N-(2-methoxy-3H-1-benzofuran-2-yl)formamide (PubChem CID 130012547) has the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. Its IUPAC name is N-(2-methoxy-3H-1-benzofuran-2-yl)formamide.
| Compound Name | N-(2-methoxy-3H-1-benzofuran-2-yl)formamide |
|---|---|
| PubChem CID | 130012547 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | N-(2-methoxy-3H-1-benzofuran-2-yl)formamide |
| SMILES | COC1(NC=O)Cc2ccccc2O1 |
| InChI | InChI=1S/C10H11NO3/c1-13-10(11-7-12)6-8-4-2-3-5-9(8)14-10/h2-5,7H,6H2,1H3,(H,11,12) |
| InChIKey | CWRZOICDNSFRDU-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|