C15H18S3 — CID 13001261
6-(3a,4,5,6,7,8,9,9a-octahydrocycloocta[d][1,3]dithiol-2-ylidene)cyclohexa-2,4-diene-1-thione (PubChem CID 13001261) has the molecular formula C15H18S3 and a molecular weight of 294.51 g/mol. Its IUPAC name is 6-(3a,4,5,6,7,8,9,9a-octahydrocycloocta[d][1,3]dithiol-2-ylidene)cyclohexa-2,4-diene-1-thione.
| Compound Name | 6-(3a,4,5,6,7,8,9,9a-octahydrocycloocta[d][1,3]dithiol-2-ylidene)cyclohexa-2,4-diene-1-thione |
|---|---|
| PubChem CID | 13001261 |
| Molecular Formula | C15H18S3 |
| Molecular Weight | 294.51 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 6-(3a,4,5,6,7,8,9,9a-octahydrocycloocta[d][1,3]dithiol-2-ylidene)cyclohexa-2,4-diene-1-thione |
| SMILES | S=C1C=CC=CC1=C1SC2CCCCCCC2S1 |
| InChI | InChI=1S/C15H18S3/c16-12-8-6-5-7-11(12)15-17-13-9-3-1-2-4-10-14(13)18-15/h5-8,13-14H,1-4,9-10H2 |
| InChIKey | CCLHZSNIZONFGX-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.51 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|