About 2,5,6-trimethyl-1H-indole-4,7-dione
2,5,6-trimethyl-1H-indole-4,7-dione (PubChem CID 130013244) has the molecular formula C11H11NO2
and a molecular weight of 189.21 g/mol. Its IUPAC name is 2,5,6-trimethyl-1H-indole-4,7-dione.
Molecular Properties
| Compound Name | 2,5,6-trimethyl-1H-indole-4,7-dione |
| PubChem CID | 130013244 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 2,5,6-trimethyl-1H-indole-4,7-dione |
| SMILES | CC1=C(C)C(=O)c2[nH]c(C)cc2C1=O |
| InChI | InChI=1S/C11H11NO2/c1-5-4-8-9(12-5)11(14)7(3)6(2)10(8)13/h4,12H,1-3H3 |
| InChIKey | PLDWLDNSBULGLD-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 2,5,6-trimethyl-1H-indole-4,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5,6-trimethyl-1H-indole-4,7-dione?
The IUPAC name of 2,5,6-trimethyl-1H-indole-4,7-dione (CID 130013244) is 2,5,6-trimethyl-1H-indole-4,7-dione.
What is the SMILES notation for 2,5,6-trimethyl-1H-indole-4,7-dione?
The canonical SMILES for 2,5,6-trimethyl-1H-indole-4,7-dione is CC1=C(C)C(=O)c2[nH]c(C)cc2C1=O.
What is the InChIKey of 2,5,6-trimethyl-1H-indole-4,7-dione?
The InChIKey is PLDWLDNSBULGLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO2/c1-5-4-8-9(12-5)11(14)7(3)6(2)10(8)13/h4,12H,1-3H3.
What are the key properties of 2,5,6-trimethyl-1H-indole-4,7-dione?
2,5,6-trimethyl-1H-indole-4,7-dione has a molecular weight of 189.21 g/mol, XLogP of 2.04, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5,6-trimethyl-1H-indole-4,7-dione is sourced from PubChem (CID 130013244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).