C11H19NO2 — CID 130014488
4-hydroxy-N,2,6,6-tetramethylcyclohex-2-ene-1-carboxamide (PubChem CID 130014488) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is 4-hydroxy-N,2,6,6-tetramethylcyclohex-2-ene-1-carboxamide.
| Compound Name | 4-hydroxy-N,2,6,6-tetramethylcyclohex-2-ene-1-carboxamide |
|---|---|
| PubChem CID | 130014488 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 4-hydroxy-N,2,6,6-tetramethylcyclohex-2-ene-1-carboxamide |
| SMILES | CNC(=O)C1C(C)=CC(O)CC1(C)C |
| InChI | InChI=1S/C11H19NO2/c1-7-5-8(13)6-11(2,3)9(7)10(14)12-4/h5,8-9,13H,6H2,1-4H3,(H,12,14) |
| InChIKey | CFIPTYUORNKPOF-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|