About N-(3-methylphenyl)-1,2,4-triazin-3-amine
N-(3-methylphenyl)-1,2,4-triazin-3-amine (PubChem CID 130015648) has the molecular formula C10H10N4
and a molecular weight of 186.22 g/mol. Its IUPAC name is N-(3-methylphenyl)-1,2,4-triazin-3-amine.
Molecular Properties
| Compound Name | N-(3-methylphenyl)-1,2,4-triazin-3-amine |
| PubChem CID | 130015648 |
| Molecular Formula | C10H10N4 |
| Molecular Weight | 186.22 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | N-(3-methylphenyl)-1,2,4-triazin-3-amine |
| SMILES | Cc1cccc(Nc2nccnn2)c1 |
| InChI | InChI=1S/C10H10N4/c1-8-3-2-4-9(7-8)13-10-11-5-6-12-14-10/h2-7H,1H3,(H,11,13,14) |
| InChIKey | HYOOVIMZPKYDKB-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.22 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-methylphenyl)-1,2,4-triazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methylphenyl)-1,2,4-triazin-3-amine?
The IUPAC name of N-(3-methylphenyl)-1,2,4-triazin-3-amine (CID 130015648) is N-(3-methylphenyl)-1,2,4-triazin-3-amine.
What is the SMILES notation for N-(3-methylphenyl)-1,2,4-triazin-3-amine?
The canonical SMILES for N-(3-methylphenyl)-1,2,4-triazin-3-amine is Cc1cccc(Nc2nccnn2)c1.
What is the InChIKey of N-(3-methylphenyl)-1,2,4-triazin-3-amine?
The InChIKey is HYOOVIMZPKYDKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4/c1-8-3-2-4-9(7-8)13-10-11-5-6-12-14-10/h2-7H,1H3,(H,11,13,14).
What are the key properties of N-(3-methylphenyl)-1,2,4-triazin-3-amine?
N-(3-methylphenyl)-1,2,4-triazin-3-amine has a molecular weight of 186.22 g/mol, XLogP of 1.92, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methylphenyl)-1,2,4-triazin-3-amine is sourced from PubChem (CID 130015648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).