About 4-(hydroxymethyl)-3,4-dihydro-2H-isoquinolin-1-one
4-(hydroxymethyl)-3,4-dihydro-2H-isoquinolin-1-one (PubChem CID 130015714) has the molecular formula C10H11NO2
and a molecular weight of 177.20 g/mol. Its IUPAC name is 4-(hydroxymethyl)-3,4-dihydro-2H-isoquinolin-1-one.
Molecular Properties
| Compound Name | 4-(hydroxymethyl)-3,4-dihydro-2H-isoquinolin-1-one |
| PubChem CID | 130015714 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 4-(hydroxymethyl)-3,4-dihydro-2H-isoquinolin-1-one |
| SMILES | O=C1NCC(CO)c2ccccc21 |
| InChI | InChI=1S/C10H11NO2/c12-6-7-5-11-10(13)9-4-2-1-3-8(7)9/h1-4,7,12H,5-6H2,(H,11,13) |
| InChIKey | LNJOLFDIACSLIT-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(hydroxymethyl)-3,4-dihydro-2H-isoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(hydroxymethyl)-3,4-dihydro-2H-isoquinolin-1-one?
The IUPAC name of 4-(hydroxymethyl)-3,4-dihydro-2H-isoquinolin-1-one (CID 130015714) is 4-(hydroxymethyl)-3,4-dihydro-2H-isoquinolin-1-one.
What is the SMILES notation for 4-(hydroxymethyl)-3,4-dihydro-2H-isoquinolin-1-one?
The canonical SMILES for 4-(hydroxymethyl)-3,4-dihydro-2H-isoquinolin-1-one is O=C1NCC(CO)c2ccccc21.
What is the InChIKey of 4-(hydroxymethyl)-3,4-dihydro-2H-isoquinolin-1-one?
The InChIKey is LNJOLFDIACSLIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2/c12-6-7-5-11-10(13)9-4-2-1-3-8(7)9/h1-4,7,12H,5-6H2,(H,11,13).
What are the key properties of 4-(hydroxymethyl)-3,4-dihydro-2H-isoquinolin-1-one?
4-(hydroxymethyl)-3,4-dihydro-2H-isoquinolin-1-one has a molecular weight of 177.20 g/mol, XLogP of 0.51, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(hydroxymethyl)-3,4-dihydro-2H-isoquinolin-1-one is sourced from PubChem (CID 130015714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).