About 2-tert-butyl-3,5-dimethyl-1H-pyrrole
2-tert-butyl-3,5-dimethyl-1H-pyrrole (PubChem CID 130016450) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is 2-tert-butyl-3,5-dimethyl-1H-pyrrole.
Molecular Properties
| Compound Name | 2-tert-butyl-3,5-dimethyl-1H-pyrrole |
| PubChem CID | 130016450 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 2-tert-butyl-3,5-dimethyl-1H-pyrrole |
| SMILES | Cc1cc(C)c(C(C)(C)C)[nH]1 |
| InChI | InChI=1S/C10H17N/c1-7-6-8(2)11-9(7)10(3,4)5/h6,11H,1-5H3 |
| InChIKey | PBRWEQDQHULKEJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-tert-butyl-3,5-dimethyl-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-3,5-dimethyl-1H-pyrrole?
The IUPAC name of 2-tert-butyl-3,5-dimethyl-1H-pyrrole (CID 130016450) is 2-tert-butyl-3,5-dimethyl-1H-pyrrole.
What is the SMILES notation for 2-tert-butyl-3,5-dimethyl-1H-pyrrole?
The canonical SMILES for 2-tert-butyl-3,5-dimethyl-1H-pyrrole is Cc1cc(C)c(C(C)(C)C)[nH]1.
What is the InChIKey of 2-tert-butyl-3,5-dimethyl-1H-pyrrole?
The InChIKey is PBRWEQDQHULKEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N/c1-7-6-8(2)11-9(7)10(3,4)5/h6,11H,1-5H3.
What are the key properties of 2-tert-butyl-3,5-dimethyl-1H-pyrrole?
2-tert-butyl-3,5-dimethyl-1H-pyrrole has a molecular weight of 151.25 g/mol, XLogP of 2.93, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-3,5-dimethyl-1H-pyrrole is sourced from PubChem (CID 130016450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).