About (4-amino-2,6-dimethylpyrimidin-5-yl) hydrogen sulfate
(4-amino-2,6-dimethylpyrimidin-5-yl) hydrogen sulfate (PubChem CID 130017433) has the molecular formula C6H9N3O4S
and a molecular weight of 219.22 g/mol. Its IUPAC name is (4-amino-2,6-dimethylpyrimidin-5-yl) hydrogen sulfate.
Molecular Properties
| Compound Name | (4-amino-2,6-dimethylpyrimidin-5-yl) hydrogen sulfate |
| PubChem CID | 130017433 |
| Molecular Formula | C6H9N3O4S |
| Molecular Weight | 219.22 g/mol |
| Exact Mass | 219.03 |
| IUPAC Name | (4-amino-2,6-dimethylpyrimidin-5-yl) hydrogen sulfate |
| SMILES | Cc1nc(C)c(OS(=O)(=O)O)c(N)n1 |
| InChI | InChI=1S/C6H9N3O4S/c1-3-5(13-14(10,11)12)6(7)9-4(2)8-3/h1-2H3,(H2,7,8,9)(H,10,11,12) |
| InChIKey | RHZOXYRPWONTRB-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 115.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.22 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze (4-amino-2,6-dimethylpyrimidin-5-yl) hydrogen sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-amino-2,6-dimethylpyrimidin-5-yl) hydrogen sulfate?
The IUPAC name of (4-amino-2,6-dimethylpyrimidin-5-yl) hydrogen sulfate (CID 130017433) is (4-amino-2,6-dimethylpyrimidin-5-yl) hydrogen sulfate.
What is the SMILES notation for (4-amino-2,6-dimethylpyrimidin-5-yl) hydrogen sulfate?
The canonical SMILES for (4-amino-2,6-dimethylpyrimidin-5-yl) hydrogen sulfate is Cc1nc(C)c(OS(=O)(=O)O)c(N)n1.
What is the InChIKey of (4-amino-2,6-dimethylpyrimidin-5-yl) hydrogen sulfate?
The InChIKey is RHZOXYRPWONTRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O4S/c1-3-5(13-14(10,11)12)6(7)9-4(2)8-3/h1-2H3,(H2,7,8,9)(H,10,11,12).
What are the key properties of (4-amino-2,6-dimethylpyrimidin-5-yl) hydrogen sulfate?
(4-amino-2,6-dimethylpyrimidin-5-yl) hydrogen sulfate has a molecular weight of 219.22 g/mol, XLogP of -0.14, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-amino-2,6-dimethylpyrimidin-5-yl) hydrogen sulfate is sourced from PubChem (CID 130017433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).