C8H11N5S — CID 130017564
7,7-dimethylpyrimido[4,5-b][1,4]thiazine-4,6-diamine (PubChem CID 130017564) has the molecular formula C8H11N5S and a molecular weight of 209.28 g/mol. Its IUPAC name is 7,7-dimethylpyrimido[4,5-b][1,4]thiazine-4,6-diamine.
| Compound Name | 7,7-dimethylpyrimido[4,5-b][1,4]thiazine-4,6-diamine |
|---|---|
| PubChem CID | 130017564 |
| Molecular Formula | C8H11N5S |
| Molecular Weight | 209.28 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 7,7-dimethylpyrimido[4,5-b][1,4]thiazine-4,6-diamine |
| SMILES | CC1(C)Sc2ncnc(N)c2N=C1N |
| InChI | InChI=1S/C8H11N5S/c1-8(2)7(10)13-4-5(9)11-3-12-6(4)14-8/h3H,1-2H3,(H2,10,13)(H2,9,11,12) |
| InChIKey | QYVGWKPDNKRBJK-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.28 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |