About 2,4-diaminobenzene-1,3,5-trithiol
2,4-diaminobenzene-1,3,5-trithiol (PubChem CID 130017911) has the molecular formula C6H8N2S3
and a molecular weight of 204.34 g/mol. Its IUPAC name is 2,4-diaminobenzene-1,3,5-trithiol.
Molecular Properties
| Compound Name | 2,4-diaminobenzene-1,3,5-trithiol |
| PubChem CID | 130017911 |
| Molecular Formula | C6H8N2S3 |
| Molecular Weight | 204.34 g/mol |
| Exact Mass | 203.98 |
| IUPAC Name | 2,4-diaminobenzene-1,3,5-trithiol |
| SMILES | Nc1c(S)cc(S)c(N)c1S |
| InChI | InChI=1S/C6H8N2S3/c7-4-2(9)1-3(10)5(8)6(4)11/h1,9-11H,7-8H2 |
| InChIKey | OVYPLTKHRNBJMW-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.34 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2,4-diaminobenzene-1,3,5-trithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diaminobenzene-1,3,5-trithiol?
The IUPAC name of 2,4-diaminobenzene-1,3,5-trithiol (CID 130017911) is 2,4-diaminobenzene-1,3,5-trithiol.
What is the SMILES notation for 2,4-diaminobenzene-1,3,5-trithiol?
The canonical SMILES for 2,4-diaminobenzene-1,3,5-trithiol is Nc1c(S)cc(S)c(N)c1S.
What is the InChIKey of 2,4-diaminobenzene-1,3,5-trithiol?
The InChIKey is OVYPLTKHRNBJMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2S3/c7-4-2(9)1-3(10)5(8)6(4)11/h1,9-11H,7-8H2.
What are the key properties of 2,4-diaminobenzene-1,3,5-trithiol?
2,4-diaminobenzene-1,3,5-trithiol has a molecular weight of 204.34 g/mol, XLogP of 1.72, 0 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diaminobenzene-1,3,5-trithiol is sourced from PubChem (CID 130017911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).