About 6-amino-1,3-benzodioxole-5-sulfonamide
6-amino-1,3-benzodioxole-5-sulfonamide (PubChem CID 130018278) has the molecular formula C7H8N2O4S
and a molecular weight of 216.22 g/mol. Its IUPAC name is 6-amino-1,3-benzodioxole-5-sulfonamide.
Molecular Properties
| Compound Name | 6-amino-1,3-benzodioxole-5-sulfonamide |
| PubChem CID | 130018278 |
| Molecular Formula | C7H8N2O4S |
| Molecular Weight | 216.22 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | 6-amino-1,3-benzodioxole-5-sulfonamide |
| SMILES | Nc1cc2c(cc1S(N)(=O)=O)OCO2 |
| InChI | InChI=1S/C7H8N2O4S/c8-4-1-5-6(13-3-12-5)2-7(4)14(9,10)11/h1-2H,3,8H2,(H2,9,10,11) |
| InChIKey | QYXPYTMWJWTOFY-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.22 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-1,3-benzodioxole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-1,3-benzodioxole-5-sulfonamide?
The IUPAC name of 6-amino-1,3-benzodioxole-5-sulfonamide (CID 130018278) is 6-amino-1,3-benzodioxole-5-sulfonamide.
What is the SMILES notation for 6-amino-1,3-benzodioxole-5-sulfonamide?
The canonical SMILES for 6-amino-1,3-benzodioxole-5-sulfonamide is Nc1cc2c(cc1S(N)(=O)=O)OCO2.
What is the InChIKey of 6-amino-1,3-benzodioxole-5-sulfonamide?
The InChIKey is QYXPYTMWJWTOFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O4S/c8-4-1-5-6(13-3-12-5)2-7(4)14(9,10)11/h1-2H,3,8H2,(H2,9,10,11).
What are the key properties of 6-amino-1,3-benzodioxole-5-sulfonamide?
6-amino-1,3-benzodioxole-5-sulfonamide has a molecular weight of 216.22 g/mol, XLogP of -0.36, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-1,3-benzodioxole-5-sulfonamide is sourced from PubChem (CID 130018278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).