About 4-amino-6-sulfanylidene-2,3-dihydrothiopyrano[4,3-b]furan-7-carbonitrile
4-amino-6-sulfanylidene-2,3-dihydrothiopyrano[4,3-b]furan-7-carbonitrile (PubChem CID 130019079) has the molecular formula C8H6N2OS2
and a molecular weight of 210.28 g/mol. Its IUPAC name is 4-amino-6-sulfanylidene-2,3-dihydrothiopyrano[4,3-b]furan-7-carbonitrile.
Molecular Properties
| Compound Name | 4-amino-6-sulfanylidene-2,3-dihydrothiopyrano[4,3-b]furan-7-carbonitrile |
| PubChem CID | 130019079 |
| Molecular Formula | C8H6N2OS2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 209.99 |
| IUPAC Name | 4-amino-6-sulfanylidene-2,3-dihydrothiopyrano[4,3-b]furan-7-carbonitrile |
| SMILES | N#Cc1c2c(c(N)sc1=S)CCO2 |
| InChI | InChI=1S/C8H6N2OS2/c9-3-5-6-4(1-2-11-6)7(10)13-8(5)12/h1-2,10H2 |
| InChIKey | UILXFBVACAPNIP-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ester_A(5)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-6-sulfanylidene-2,3-dihydrothiopyrano[4,3-b]furan-7-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-6-sulfanylidene-2,3-dihydrothiopyrano[4,3-b]furan-7-carbonitrile?
The IUPAC name of 4-amino-6-sulfanylidene-2,3-dihydrothiopyrano[4,3-b]furan-7-carbonitrile (CID 130019079) is 4-amino-6-sulfanylidene-2,3-dihydrothiopyrano[4,3-b]furan-7-carbonitrile.
What is the SMILES notation for 4-amino-6-sulfanylidene-2,3-dihydrothiopyrano[4,3-b]furan-7-carbonitrile?
The canonical SMILES for 4-amino-6-sulfanylidene-2,3-dihydrothiopyrano[4,3-b]furan-7-carbonitrile is N#Cc1c2c(c(N)sc1=S)CCO2.
What is the InChIKey of 4-amino-6-sulfanylidene-2,3-dihydrothiopyrano[4,3-b]furan-7-carbonitrile?
The InChIKey is UILXFBVACAPNIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2OS2/c9-3-5-6-4(1-2-11-6)7(10)13-8(5)12/h1-2,10H2.
What are the key properties of 4-amino-6-sulfanylidene-2,3-dihydrothiopyrano[4,3-b]furan-7-carbonitrile?
4-amino-6-sulfanylidene-2,3-dihydrothiopyrano[4,3-b]furan-7-carbonitrile has a molecular weight of 210.28 g/mol, XLogP of 1.87, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-6-sulfanylidene-2,3-dihydrothiopyrano[4,3-b]furan-7-carbonitrile is sourced from PubChem (CID 130019079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).