About 4-ethenylhexa-3,5-dien-1-amine
4-ethenylhexa-3,5-dien-1-amine (PubChem CID 130019176) has the molecular formula C8H13N
and a molecular weight of 123.20 g/mol. Its IUPAC name is 4-ethenylhexa-3,5-dien-1-amine.
Molecular Properties
| Compound Name | 4-ethenylhexa-3,5-dien-1-amine |
| PubChem CID | 130019176 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | 4-ethenylhexa-3,5-dien-1-amine |
| SMILES | C=CC(C=C)=CCCN |
| InChI | InChI=1S/C8H13N/c1-3-8(4-2)6-5-7-9/h3-4,6H,1-2,5,7,9H2 |
| InChIKey | RWCHXOMTOQBKDF-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-ethenylhexa-3,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenylhexa-3,5-dien-1-amine?
The IUPAC name of 4-ethenylhexa-3,5-dien-1-amine (CID 130019176) is 4-ethenylhexa-3,5-dien-1-amine.
What is the SMILES notation for 4-ethenylhexa-3,5-dien-1-amine?
The canonical SMILES for 4-ethenylhexa-3,5-dien-1-amine is C=CC(C=C)=CCCN.
What is the InChIKey of 4-ethenylhexa-3,5-dien-1-amine?
The InChIKey is RWCHXOMTOQBKDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N/c1-3-8(4-2)6-5-7-9/h3-4,6H,1-2,5,7,9H2.
What are the key properties of 4-ethenylhexa-3,5-dien-1-amine?
4-ethenylhexa-3,5-dien-1-amine has a molecular weight of 123.20 g/mol, XLogP of 1.63, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenylhexa-3,5-dien-1-amine is sourced from PubChem (CID 130019176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).