C13H23N — CID 130019239
(E)-2,2,8,8-tetramethylnon-4-en-6-yn-1-amine (PubChem CID 130019239) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is (E)-2,2,8,8-tetramethylnon-4-en-6-yn-1-amine.
| Compound Name | (E)-2,2,8,8-tetramethylnon-4-en-6-yn-1-amine |
|---|---|
| PubChem CID | 130019239 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | (E)-2,2,8,8-tetramethylnon-4-en-6-yn-1-amine |
| SMILES | CC(C)(C)C#C/C=C/CC(C)(C)CN |
| InChI | InChI=1S/C13H23N/c1-12(2,3)9-7-6-8-10-13(4,5)11-14/h6,8H,10-11,14H2,1-5H3/b8-6+ |
| InChIKey | SVNRECRCEGVVHE-SOFGYWHQSA-N |
| XLogP | 2.97 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|