About 3-(3-chloro-1,2,4-triazol-1-yl)pyridin-2-amine
3-(3-chloro-1,2,4-triazol-1-yl)pyridin-2-amine (PubChem CID 130019418) has the molecular formula C7H6ClN5
and a molecular weight of 195.61 g/mol. Its IUPAC name is 3-(3-chloro-1,2,4-triazol-1-yl)pyridin-2-amine.
Molecular Properties
| Compound Name | 3-(3-chloro-1,2,4-triazol-1-yl)pyridin-2-amine |
| PubChem CID | 130019418 |
| Molecular Formula | C7H6ClN5 |
| Molecular Weight | 195.61 g/mol |
| Exact Mass | 195.03 |
| IUPAC Name | 3-(3-chloro-1,2,4-triazol-1-yl)pyridin-2-amine |
| SMILES | Nc1ncccc1-n1cnc(Cl)n1 |
| InChI | InChI=1S/C7H6ClN5/c8-7-11-4-13(12-7)5-2-1-3-10-6(5)9/h1-4H,(H2,9,10) |
| InChIKey | XWOSEJRVDFDUDW-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.61 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(3-chloro-1,2,4-triazol-1-yl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-chloro-1,2,4-triazol-1-yl)pyridin-2-amine?
The IUPAC name of 3-(3-chloro-1,2,4-triazol-1-yl)pyridin-2-amine (CID 130019418) is 3-(3-chloro-1,2,4-triazol-1-yl)pyridin-2-amine.
What is the SMILES notation for 3-(3-chloro-1,2,4-triazol-1-yl)pyridin-2-amine?
The canonical SMILES for 3-(3-chloro-1,2,4-triazol-1-yl)pyridin-2-amine is Nc1ncccc1-n1cnc(Cl)n1.
What is the InChIKey of 3-(3-chloro-1,2,4-triazol-1-yl)pyridin-2-amine?
The InChIKey is XWOSEJRVDFDUDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClN5/c8-7-11-4-13(12-7)5-2-1-3-10-6(5)9/h1-4H,(H2,9,10).
What are the key properties of 3-(3-chloro-1,2,4-triazol-1-yl)pyridin-2-amine?
3-(3-chloro-1,2,4-triazol-1-yl)pyridin-2-amine has a molecular weight of 195.61 g/mol, XLogP of 0.90, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-chloro-1,2,4-triazol-1-yl)pyridin-2-amine is sourced from PubChem (CID 130019418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).