About 7-amino-5-butylpyrazolo[1,5-a]pyrimidin-3-ol
7-amino-5-butylpyrazolo[1,5-a]pyrimidin-3-ol (PubChem CID 130019492) has the molecular formula C10H14N4O
and a molecular weight of 206.25 g/mol. Its IUPAC name is 7-amino-5-butylpyrazolo[1,5-a]pyrimidin-3-ol.
Molecular Properties
| Compound Name | 7-amino-5-butylpyrazolo[1,5-a]pyrimidin-3-ol |
| PubChem CID | 130019492 |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 7-amino-5-butylpyrazolo[1,5-a]pyrimidin-3-ol |
| SMILES | CCCCc1cc(N)n2ncc(O)c2n1 |
| InChI | InChI=1S/C10H14N4O/c1-2-3-4-7-5-9(11)14-10(13-7)8(15)6-12-14/h5-6,15H,2-4,11H2,1H3 |
| InChIKey | VKRWZFFYDXRJLG-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-amino-5-butylpyrazolo[1,5-a]pyrimidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-5-butylpyrazolo[1,5-a]pyrimidin-3-ol?
The IUPAC name of 7-amino-5-butylpyrazolo[1,5-a]pyrimidin-3-ol (CID 130019492) is 7-amino-5-butylpyrazolo[1,5-a]pyrimidin-3-ol.
What is the SMILES notation for 7-amino-5-butylpyrazolo[1,5-a]pyrimidin-3-ol?
The canonical SMILES for 7-amino-5-butylpyrazolo[1,5-a]pyrimidin-3-ol is CCCCc1cc(N)n2ncc(O)c2n1.
What is the InChIKey of 7-amino-5-butylpyrazolo[1,5-a]pyrimidin-3-ol?
The InChIKey is VKRWZFFYDXRJLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4O/c1-2-3-4-7-5-9(11)14-10(13-7)8(15)6-12-14/h5-6,15H,2-4,11H2,1H3.
What are the key properties of 7-amino-5-butylpyrazolo[1,5-a]pyrimidin-3-ol?
7-amino-5-butylpyrazolo[1,5-a]pyrimidin-3-ol has a molecular weight of 206.25 g/mol, XLogP of 1.36, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-5-butylpyrazolo[1,5-a]pyrimidin-3-ol is sourced from PubChem (CID 130019492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).