C7H10N2O2S2 — CID 130019502
2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl)acetamide (PubChem CID 130019502) has the molecular formula C7H10N2O2S2 and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl)acetamide.
| Compound Name | 2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl)acetamide |
|---|---|
| PubChem CID | 130019502 |
| Molecular Formula | C7H10N2O2S2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.02 |
| IUPAC Name | 2-(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl)acetamide |
| SMILES | CCN1C(=O)C(CC(N)=O)SC1=S |
| InChI | InChI=1S/C7H10N2O2S2/c1-2-9-6(11)4(3-5(8)10)13-7(9)12/h4H,2-3H2,1H3,(H2,8,10) |
| InChIKey | PMAMMRVTRSLBAU-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|