About 4,10-dichloro-2-azatricyclo[3.3.1.13,7]decane
4,10-dichloro-2-azatricyclo[3.3.1.13,7]decane (PubChem CID 130020808) has the molecular formula C9H13Cl2N
and a molecular weight of 206.12 g/mol. Its IUPAC name is 4,10-dichloro-2-azatricyclo[3.3.1.13,7]decane.
Molecular Properties
| Compound Name | 4,10-dichloro-2-azatricyclo[3.3.1.13,7]decane |
| PubChem CID | 130020808 |
| Molecular Formula | C9H13Cl2N |
| Molecular Weight | 206.12 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | 4,10-dichloro-2-azatricyclo[3.3.1.13,7]decane |
| SMILES | ClC1C2CC3CC(C2)C(Cl)C1N3 |
| InChI | InChI=1S/C9H13Cl2N/c10-7-4-1-5-3-6(2-4)12-9(7)8(5)11/h4-9,12H,1-3H2 |
| InChIKey | OYHHAZBJBMVXIR-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.12 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4,10-dichloro-2-azatricyclo[3.3.1.13,7]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,10-dichloro-2-azatricyclo[3.3.1.13,7]decane?
The IUPAC name of 4,10-dichloro-2-azatricyclo[3.3.1.13,7]decane (CID 130020808) is 4,10-dichloro-2-azatricyclo[3.3.1.13,7]decane.
What is the SMILES notation for 4,10-dichloro-2-azatricyclo[3.3.1.13,7]decane?
The canonical SMILES for 4,10-dichloro-2-azatricyclo[3.3.1.13,7]decane is ClC1C2CC3CC(C2)C(Cl)C1N3.
What is the InChIKey of 4,10-dichloro-2-azatricyclo[3.3.1.13,7]decane?
The InChIKey is OYHHAZBJBMVXIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13Cl2N/c10-7-4-1-5-3-6(2-4)12-9(7)8(5)11/h4-9,12H,1-3H2.
What are the key properties of 4,10-dichloro-2-azatricyclo[3.3.1.13,7]decane?
4,10-dichloro-2-azatricyclo[3.3.1.13,7]decane has a molecular weight of 206.12 g/mol, XLogP of 1.97, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,10-dichloro-2-azatricyclo[3.3.1.13,7]decane is sourced from PubChem (CID 130020808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).