About (2-amino-4,8-dioxatricyclo[4.2.1.03,7]nonan-9-yl)methanol
(2-amino-4,8-dioxatricyclo[4.2.1.03,7]nonan-9-yl)methanol (PubChem CID 130023380) has the molecular formula C8H13NO3
and a molecular weight of 171.20 g/mol. Its IUPAC name is (2-amino-4,8-dioxatricyclo[4.2.1.03,7]nonan-9-yl)methanol.
Molecular Properties
| Compound Name | (2-amino-4,8-dioxatricyclo[4.2.1.03,7]nonan-9-yl)methanol |
| PubChem CID | 130023380 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | (2-amino-4,8-dioxatricyclo[4.2.1.03,7]nonan-9-yl)methanol |
| SMILES | NC1C2OC3C(COC13)C2CO |
| InChI | InChI=1S/C8H13NO3/c9-5-6-3(1-10)4-2-11-8(5)7(4)12-6/h3-8,10H,1-2,9H2 |
| InChIKey | FBXNFFFOIMHPOC-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-amino-4,8-dioxatricyclo[4.2.1.03,7]nonan-9-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-4,8-dioxatricyclo[4.2.1.03,7]nonan-9-yl)methanol?
The IUPAC name of (2-amino-4,8-dioxatricyclo[4.2.1.03,7]nonan-9-yl)methanol (CID 130023380) is (2-amino-4,8-dioxatricyclo[4.2.1.03,7]nonan-9-yl)methanol.
What is the SMILES notation for (2-amino-4,8-dioxatricyclo[4.2.1.03,7]nonan-9-yl)methanol?
The canonical SMILES for (2-amino-4,8-dioxatricyclo[4.2.1.03,7]nonan-9-yl)methanol is NC1C2OC3C(COC13)C2CO.
What is the InChIKey of (2-amino-4,8-dioxatricyclo[4.2.1.03,7]nonan-9-yl)methanol?
The InChIKey is FBXNFFFOIMHPOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO3/c9-5-6-3(1-10)4-2-11-8(5)7(4)12-6/h3-8,10H,1-2,9H2.
What are the key properties of (2-amino-4,8-dioxatricyclo[4.2.1.03,7]nonan-9-yl)methanol?
(2-amino-4,8-dioxatricyclo[4.2.1.03,7]nonan-9-yl)methanol has a molecular weight of 171.20 g/mol, XLogP of -1.28, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-4,8-dioxatricyclo[4.2.1.03,7]nonan-9-yl)methanol is sourced from PubChem (CID 130023380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).