C12H21NO2 — CID 130023651
4,7-dimethylspiro[1,2,3,4,4a,5,7,7a-octahydrocyclopenta[c]pyridine-6,2'-1,3-dioxolane] (PubChem CID 130023651) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is 4,7-dimethylspiro[1,2,3,4,4a,5,7,7a-octahydrocyclopenta[c]pyridine-6,2'-1,3-dioxolane].
| Compound Name | 4,7-dimethylspiro[1,2,3,4,4a,5,7,7a-octahydrocyclopenta[c]pyridine-6,2'-1,3-dioxolane] |
|---|---|
| PubChem CID | 130023651 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 4,7-dimethylspiro[1,2,3,4,4a,5,7,7a-octahydrocyclopenta[c]pyridine-6,2'-1,3-dioxolane] |
| SMILES | CC1CNCC2C1CC1(OCCO1)C2C |
| InChI | InChI=1S/C12H21NO2/c1-8-6-13-7-11-9(2)12(5-10(8)11)14-3-4-15-12/h8-11,13H,3-7H2,1-2H3 |
| InChIKey | JKNJLSVHRCNCER-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |