C8H10N2O3 — CID 130024021
2,2-dimethyl-4-oxo-3a,5,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-6-carbonitrile (PubChem CID 130024021) has the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. Its IUPAC name is 2,2-dimethyl-4-oxo-3a,5,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-6-carbonitrile.
| Compound Name | 2,2-dimethyl-4-oxo-3a,5,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-6-carbonitrile |
|---|---|
| PubChem CID | 130024021 |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 2,2-dimethyl-4-oxo-3a,5,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-6-carbonitrile |
| SMILES | CC1(C)OC2C(=O)NC(C#N)C2O1 |
| InChI | InChI=1S/C8H10N2O3/c1-8(2)12-5-4(3-9)10-7(11)6(5)13-8/h4-6H,1-2H3,(H,10,11) |
| InChIKey | GTYHOSXGTFIVAQ-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |