C10H16N2O — CID 130024085
5-but-3-enyl-3-methyl-1,3,6,7-tetrahydro-1,4-diazepin-2-one (PubChem CID 130024085) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 5-but-3-enyl-3-methyl-1,3,6,7-tetrahydro-1,4-diazepin-2-one.
| Compound Name | 5-but-3-enyl-3-methyl-1,3,6,7-tetrahydro-1,4-diazepin-2-one |
|---|---|
| PubChem CID | 130024085 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 5-but-3-enyl-3-methyl-1,3,6,7-tetrahydro-1,4-diazepin-2-one |
| SMILES | C=CCCC1=NC(C)C(=O)NCC1 |
| InChI | InChI=1S/C10H16N2O/c1-3-4-5-9-6-7-11-10(13)8(2)12-9/h3,8H,1,4-7H2,2H3,(H,11,13) |
| InChIKey | QQFCWWCQMFTGDJ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|