About methyl N-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]carbamate
methyl N-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]carbamate (PubChem CID 130024154) has the molecular formula C9H17NO4
and a molecular weight of 203.24 g/mol. Its IUPAC name is methyl N-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]carbamate.
Analyze methyl N-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]carbamate?
The IUPAC name of methyl N-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]carbamate (CID 130024154) is methyl N-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]carbamate.
What is the SMILES notation for methyl N-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]carbamate?
The canonical SMILES for methyl N-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]carbamate is COC(=O)NC(C)C1COC(C)(C)O1.
What is the InChIKey of methyl N-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]carbamate?
The InChIKey is NXQHNRCFCOUXPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO4/c1-6(10-8(11)12-4)7-5-13-9(2,3)14-7/h6-7H,5H2,1-4H3,(H,10,11).
What are the key properties of methyl N-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]carbamate?
methyl N-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]carbamate has a molecular weight of 203.24 g/mol, XLogP of 0.88, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[1-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]carbamate is sourced from PubChem (CID 130024154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).