About 6-(trifluoromethyl)-3,4-dihydro-1H-isochromen-4-amine
6-(trifluoromethyl)-3,4-dihydro-1H-isochromen-4-amine (PubChem CID 130024513) has the molecular formula C10H10F3NO
and a molecular weight of 217.19 g/mol. Its IUPAC name is 6-(trifluoromethyl)-3,4-dihydro-1H-isochromen-4-amine.
Molecular Properties
| Compound Name | 6-(trifluoromethyl)-3,4-dihydro-1H-isochromen-4-amine |
| PubChem CID | 130024513 |
| Molecular Formula | C10H10F3NO |
| Molecular Weight | 217.19 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 6-(trifluoromethyl)-3,4-dihydro-1H-isochromen-4-amine |
| SMILES | NC1COCc2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C10H10F3NO/c11-10(12,13)7-2-1-6-4-15-5-9(14)8(6)3-7/h1-3,9H,4-5,14H2 |
| InChIKey | ZZEDJKQJAZWELU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.19 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(trifluoromethyl)-3,4-dihydro-1H-isochromen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(trifluoromethyl)-3,4-dihydro-1H-isochromen-4-amine?
The IUPAC name of 6-(trifluoromethyl)-3,4-dihydro-1H-isochromen-4-amine (CID 130024513) is 6-(trifluoromethyl)-3,4-dihydro-1H-isochromen-4-amine.
What is the SMILES notation for 6-(trifluoromethyl)-3,4-dihydro-1H-isochromen-4-amine?
The canonical SMILES for 6-(trifluoromethyl)-3,4-dihydro-1H-isochromen-4-amine is NC1COCc2ccc(C(F)(F)F)cc21.
What is the InChIKey of 6-(trifluoromethyl)-3,4-dihydro-1H-isochromen-4-amine?
The InChIKey is ZZEDJKQJAZWELU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F3NO/c11-10(12,13)7-2-1-6-4-15-5-9(14)8(6)3-7/h1-3,9H,4-5,14H2.
What are the key properties of 6-(trifluoromethyl)-3,4-dihydro-1H-isochromen-4-amine?
6-(trifluoromethyl)-3,4-dihydro-1H-isochromen-4-amine has a molecular weight of 217.19 g/mol, XLogP of 2.24, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(trifluoromethyl)-3,4-dihydro-1H-isochromen-4-amine is sourced from PubChem (CID 130024513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).