C9H10O2 — CID 130025271
2-[1-(2-oxoethyl)cyclopenta-2,4-dien-1-yl]acetaldehyde (PubChem CID 130025271) has the molecular formula C9H10O2 and a molecular weight of 150.18 g/mol. Its IUPAC name is 2-[1-(2-oxoethyl)cyclopenta-2,4-dien-1-yl]acetaldehyde.
| Compound Name | 2-[1-(2-oxoethyl)cyclopenta-2,4-dien-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 130025271 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 2-[1-(2-oxoethyl)cyclopenta-2,4-dien-1-yl]acetaldehyde |
| SMILES | O=CCC1(CC=O)C=CC=C1 |
| InChI | InChI=1S/C9H10O2/c10-7-5-9(6-8-11)3-1-2-4-9/h1-4,7-8H,5-6H2 |
| InChIKey | PHTSNFHLIGNSDZ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|