About 3-(2-adamantyl)propanal
3-(2-adamantyl)propanal (PubChem CID 130025353) has the molecular formula C13H20O
and a molecular weight of 192.30 g/mol. Its IUPAC name is 3-(2-adamantyl)propanal.
Molecular Properties
| Compound Name | 3-(2-adamantyl)propanal |
| PubChem CID | 130025353 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | 3-(2-adamantyl)propanal |
| SMILES | O=CCCC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C13H20O/c14-3-1-2-13-11-5-9-4-10(7-11)8-12(13)6-9/h3,9-13H,1-2,4-8H2 |
| InChIKey | ULVDAUKDWHALSH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-adamantyl)propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-adamantyl)propanal?
The IUPAC name of 3-(2-adamantyl)propanal (CID 130025353) is 3-(2-adamantyl)propanal.
What is the SMILES notation for 3-(2-adamantyl)propanal?
The canonical SMILES for 3-(2-adamantyl)propanal is O=CCCC1C2CC3CC(C2)CC1C3.
What is the InChIKey of 3-(2-adamantyl)propanal?
The InChIKey is ULVDAUKDWHALSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O/c14-3-1-2-13-11-5-9-4-10(7-11)8-12(13)6-9/h3,9-13H,1-2,4-8H2.
What are the key properties of 3-(2-adamantyl)propanal?
3-(2-adamantyl)propanal has a molecular weight of 192.30 g/mol, XLogP of 3.04, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-adamantyl)propanal is sourced from PubChem (CID 130025353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).