C10H12N2O2 — CID 130025874
6-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidine-9-carbaldehyde (PubChem CID 130025874) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 6-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidine-9-carbaldehyde.
| Compound Name | 6-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidine-9-carbaldehyde |
|---|---|
| PubChem CID | 130025874 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 6-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidine-9-carbaldehyde |
| SMILES | CC1CCC(C=O)c2nccc(=O)n21 |
| InChI | InChI=1S/C10H12N2O2/c1-7-2-3-8(6-13)10-11-5-4-9(14)12(7)10/h4-8H,2-3H2,1H3 |
| InChIKey | CTEKFEFUJWTPEF-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|