About 1,3-dihydro-2-benzofuran-5,6-dicarbaldehyde
1,3-dihydro-2-benzofuran-5,6-dicarbaldehyde (PubChem CID 130026369) has the molecular formula C10H8O3
and a molecular weight of 176.17 g/mol. Its IUPAC name is 1,3-dihydro-2-benzofuran-5,6-dicarbaldehyde.
Molecular Properties
| Compound Name | 1,3-dihydro-2-benzofuran-5,6-dicarbaldehyde |
| PubChem CID | 130026369 |
| Molecular Formula | C10H8O3 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.05 |
| IUPAC Name | 1,3-dihydro-2-benzofuran-5,6-dicarbaldehyde |
| SMILES | O=Cc1cc2c(cc1C=O)COC2 |
| InChI | InChI=1S/C10H8O3/c11-3-7-1-9-5-13-6-10(9)2-8(7)4-12/h1-4H,5-6H2 |
| InChIKey | XXRYURWLUZNEMP-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dihydro-2-benzofuran-5,6-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dihydro-2-benzofuran-5,6-dicarbaldehyde?
The IUPAC name of 1,3-dihydro-2-benzofuran-5,6-dicarbaldehyde (CID 130026369) is 1,3-dihydro-2-benzofuran-5,6-dicarbaldehyde.
What is the SMILES notation for 1,3-dihydro-2-benzofuran-5,6-dicarbaldehyde?
The canonical SMILES for 1,3-dihydro-2-benzofuran-5,6-dicarbaldehyde is O=Cc1cc2c(cc1C=O)COC2.
What is the InChIKey of 1,3-dihydro-2-benzofuran-5,6-dicarbaldehyde?
The InChIKey is XXRYURWLUZNEMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O3/c11-3-7-1-9-5-13-6-10(9)2-8(7)4-12/h1-4H,5-6H2.
What are the key properties of 1,3-dihydro-2-benzofuran-5,6-dicarbaldehyde?
1,3-dihydro-2-benzofuran-5,6-dicarbaldehyde has a molecular weight of 176.17 g/mol, XLogP of 1.34, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dihydro-2-benzofuran-5,6-dicarbaldehyde is sourced from PubChem (CID 130026369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).