C11H19N3O — CID 13002712
spiro[1,5,6,7,8,8a-hexahydroimidazo[1,2-a]pyridine-3,4'-piperidine]-2-one (PubChem CID 13002712) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is spiro[1,5,6,7,8,8a-hexahydroimidazo[1,2-a]pyridine-3,4'-piperidine]-2-one.
| Compound Name | spiro[1,5,6,7,8,8a-hexahydroimidazo[1,2-a]pyridine-3,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 13002712 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | spiro[1,5,6,7,8,8a-hexahydroimidazo[1,2-a]pyridine-3,4'-piperidine]-2-one |
| SMILES | O=C1NC2CCCCN2C12CCNCC2 |
| InChI | InChI=1S/C11H19N3O/c15-10-11(4-6-12-7-5-11)14-8-2-1-3-9(14)13-10/h9,12H,1-8H2,(H,13,15) |
| InChIKey | WLYWLYVXPCRCCU-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |