About 6-fluoro-3,5-dimethoxycyclohexa-2,4-dien-1-one
6-fluoro-3,5-dimethoxycyclohexa-2,4-dien-1-one (PubChem CID 130027176) has the molecular formula C8H9FO3
and a molecular weight of 172.15 g/mol. Its IUPAC name is 6-fluoro-3,5-dimethoxycyclohexa-2,4-dien-1-one.
Molecular Properties
| Compound Name | 6-fluoro-3,5-dimethoxycyclohexa-2,4-dien-1-one |
| PubChem CID | 130027176 |
| Molecular Formula | C8H9FO3 |
| Molecular Weight | 172.15 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | 6-fluoro-3,5-dimethoxycyclohexa-2,4-dien-1-one |
| SMILES | COC1=CC(=O)C(F)C(OC)=C1 |
| InChI | InChI=1S/C8H9FO3/c1-11-5-3-6(10)8(9)7(4-5)12-2/h3-4,8H,1-2H3 |
| InChIKey | LWHZZKUFMKSCMG-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.15 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-fluoro-3,5-dimethoxycyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-3,5-dimethoxycyclohexa-2,4-dien-1-one?
The IUPAC name of 6-fluoro-3,5-dimethoxycyclohexa-2,4-dien-1-one (CID 130027176) is 6-fluoro-3,5-dimethoxycyclohexa-2,4-dien-1-one.
What is the SMILES notation for 6-fluoro-3,5-dimethoxycyclohexa-2,4-dien-1-one?
The canonical SMILES for 6-fluoro-3,5-dimethoxycyclohexa-2,4-dien-1-one is COC1=CC(=O)C(F)C(OC)=C1.
What is the InChIKey of 6-fluoro-3,5-dimethoxycyclohexa-2,4-dien-1-one?
The InChIKey is LWHZZKUFMKSCMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9FO3/c1-11-5-3-6(10)8(9)7(4-5)12-2/h3-4,8H,1-2H3.
What are the key properties of 6-fluoro-3,5-dimethoxycyclohexa-2,4-dien-1-one?
6-fluoro-3,5-dimethoxycyclohexa-2,4-dien-1-one has a molecular weight of 172.15 g/mol, XLogP of 0.97, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-3,5-dimethoxycyclohexa-2,4-dien-1-one is sourced from PubChem (CID 130027176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).