About 1,4-dimethyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione
1,4-dimethyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione (PubChem CID 130028019) has the molecular formula C8H8O3
and a molecular weight of 152.15 g/mol. Its IUPAC name is 1,4-dimethyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione.
Molecular Properties
| Compound Name | 1,4-dimethyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione |
| PubChem CID | 130028019 |
| Molecular Formula | C8H8O3 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.05 |
| IUPAC Name | 1,4-dimethyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione |
| SMILES | CC1=CC(=O)C2(C)OC2C1=O |
| InChI | InChI=1S/C8H8O3/c1-4-3-5(9)8(2)7(11-8)6(4)10/h3,7H,1-2H3 |
| InChIKey | LKLOFYOUXFUYES-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dimethyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione?
The IUPAC name of 1,4-dimethyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione (CID 130028019) is 1,4-dimethyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione.
What is the SMILES notation for 1,4-dimethyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione?
The canonical SMILES for 1,4-dimethyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione is CC1=CC(=O)C2(C)OC2C1=O.
What is the InChIKey of 1,4-dimethyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione?
The InChIKey is LKLOFYOUXFUYES-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3/c1-4-3-5(9)8(2)7(11-8)6(4)10/h3,7H,1-2H3.
What are the key properties of 1,4-dimethyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione?
1,4-dimethyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione has a molecular weight of 152.15 g/mol, XLogP of 0.24, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione is sourced from PubChem (CID 130028019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).