About 1-[dimethyl(oxo)-λ6-sulfanylidene]-3,3-dimethylbutan-2-one
1-[dimethyl(oxo)-λ6-sulfanylidene]-3,3-dimethylbutan-2-one (PubChem CID 130028520) has the molecular formula C8H16O2S
and a molecular weight of 176.28 g/mol. Its IUPAC name is 1-[dimethyl(oxo)-λ6-sulfanylidene]-3,3-dimethylbutan-2-one.
Molecular Properties
| Compound Name | 1-[dimethyl(oxo)-λ6-sulfanylidene]-3,3-dimethylbutan-2-one |
| PubChem CID | 130028520 |
| Molecular Formula | C8H16O2S |
| Molecular Weight | 176.28 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 1-[dimethyl(oxo)-λ6-sulfanylidene]-3,3-dimethylbutan-2-one |
| SMILES | CC(C)(C)C(=O)C=S(C)(C)=O |
| InChI | InChI=1S/C8H16O2S/c1-8(2,3)7(9)6-11(4,5)10/h6H,1-5H3 |
| InChIKey | POKCAYNCFBAOHE-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.28 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[dimethyl(oxo)-λ6-sulfanylidene]-3,3-dimethylbutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[dimethyl(oxo)-λ6-sulfanylidene]-3,3-dimethylbutan-2-one?
The IUPAC name of 1-[dimethyl(oxo)-λ6-sulfanylidene]-3,3-dimethylbutan-2-one (CID 130028520) is 1-[dimethyl(oxo)-λ6-sulfanylidene]-3,3-dimethylbutan-2-one.
What is the SMILES notation for 1-[dimethyl(oxo)-λ6-sulfanylidene]-3,3-dimethylbutan-2-one?
The canonical SMILES for 1-[dimethyl(oxo)-λ6-sulfanylidene]-3,3-dimethylbutan-2-one is CC(C)(C)C(=O)C=S(C)(C)=O.
What is the InChIKey of 1-[dimethyl(oxo)-λ6-sulfanylidene]-3,3-dimethylbutan-2-one?
The InChIKey is POKCAYNCFBAOHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2S/c1-8(2,3)7(9)6-11(4,5)10/h6H,1-5H3.
What are the key properties of 1-[dimethyl(oxo)-λ6-sulfanylidene]-3,3-dimethylbutan-2-one?
1-[dimethyl(oxo)-λ6-sulfanylidene]-3,3-dimethylbutan-2-one has a molecular weight of 176.28 g/mol, XLogP of 0.95, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[dimethyl(oxo)-λ6-sulfanylidene]-3,3-dimethylbutan-2-one is sourced from PubChem (CID 130028520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).