About 7-methoxy-6-methylbicyclo[3.2.0]hepta-3,6-dien-2-one
7-methoxy-6-methylbicyclo[3.2.0]hepta-3,6-dien-2-one (PubChem CID 130029584) has the molecular formula C9H10O2
and a molecular weight of 150.18 g/mol. Its IUPAC name is 7-methoxy-6-methylbicyclo[3.2.0]hepta-3,6-dien-2-one.
Analyze 7-methoxy-6-methylbicyclo[3.2.0]hepta-3,6-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-6-methylbicyclo[3.2.0]hepta-3,6-dien-2-one?
The IUPAC name of 7-methoxy-6-methylbicyclo[3.2.0]hepta-3,6-dien-2-one (CID 130029584) is 7-methoxy-6-methylbicyclo[3.2.0]hepta-3,6-dien-2-one.
What is the SMILES notation for 7-methoxy-6-methylbicyclo[3.2.0]hepta-3,6-dien-2-one?
The canonical SMILES for 7-methoxy-6-methylbicyclo[3.2.0]hepta-3,6-dien-2-one is COC1=C(C)C2C=CC(=O)C12.
What is the InChIKey of 7-methoxy-6-methylbicyclo[3.2.0]hepta-3,6-dien-2-one?
The InChIKey is GFCPWBKRSBOURG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2/c1-5-6-3-4-7(10)8(6)9(5)11-2/h3-4,6,8H,1-2H3.
What are the key properties of 7-methoxy-6-methylbicyclo[3.2.0]hepta-3,6-dien-2-one?
7-methoxy-6-methylbicyclo[3.2.0]hepta-3,6-dien-2-one has a molecular weight of 150.18 g/mol, XLogP of 1.29, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-6-methylbicyclo[3.2.0]hepta-3,6-dien-2-one is sourced from PubChem (CID 130029584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).