About 7-methoxy-5-methylbicyclo[3.2.0]hepta-3,6-dien-2-one
7-methoxy-5-methylbicyclo[3.2.0]hepta-3,6-dien-2-one (PubChem CID 130029591) has the molecular formula C9H10O2
and a molecular weight of 150.18 g/mol. Its IUPAC name is 7-methoxy-5-methylbicyclo[3.2.0]hepta-3,6-dien-2-one.
Molecular Properties
| Compound Name | 7-methoxy-5-methylbicyclo[3.2.0]hepta-3,6-dien-2-one |
| PubChem CID | 130029591 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 7-methoxy-5-methylbicyclo[3.2.0]hepta-3,6-dien-2-one |
| SMILES | COC1=CC2(C)C=CC(=O)C12 |
| InChI | InChI=1S/C9H10O2/c1-9-4-3-6(10)8(9)7(5-9)11-2/h3-5,8H,1-2H3 |
| InChIKey | KTJXSWGTRQNBBL-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-methoxy-5-methylbicyclo[3.2.0]hepta-3,6-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-5-methylbicyclo[3.2.0]hepta-3,6-dien-2-one?
The IUPAC name of 7-methoxy-5-methylbicyclo[3.2.0]hepta-3,6-dien-2-one (CID 130029591) is 7-methoxy-5-methylbicyclo[3.2.0]hepta-3,6-dien-2-one.
What is the SMILES notation for 7-methoxy-5-methylbicyclo[3.2.0]hepta-3,6-dien-2-one?
The canonical SMILES for 7-methoxy-5-methylbicyclo[3.2.0]hepta-3,6-dien-2-one is COC1=CC2(C)C=CC(=O)C12.
What is the InChIKey of 7-methoxy-5-methylbicyclo[3.2.0]hepta-3,6-dien-2-one?
The InChIKey is KTJXSWGTRQNBBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2/c1-9-4-3-6(10)8(9)7(5-9)11-2/h3-5,8H,1-2H3.
What are the key properties of 7-methoxy-5-methylbicyclo[3.2.0]hepta-3,6-dien-2-one?
7-methoxy-5-methylbicyclo[3.2.0]hepta-3,6-dien-2-one has a molecular weight of 150.18 g/mol, XLogP of 1.29, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-5-methylbicyclo[3.2.0]hepta-3,6-dien-2-one is sourced from PubChem (CID 130029591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).