C12H18O — CID 130029702
3,4,4a,4b,5,6,7,8,8a,8b-decahydro-2H-biphenylen-1-one (PubChem CID 130029702) has the molecular formula C12H18O and a molecular weight of 178.27 g/mol. Its IUPAC name is 3,4,4a,4b,5,6,7,8,8a,8b-decahydro-2H-biphenylen-1-one.
| Compound Name | 3,4,4a,4b,5,6,7,8,8a,8b-decahydro-2H-biphenylen-1-one |
|---|---|
| PubChem CID | 130029702 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | 3,4,4a,4b,5,6,7,8,8a,8b-decahydro-2H-biphenylen-1-one |
| SMILES | O=C1CCCC2C3CCCCC3C12 |
| InChI | InChI=1S/C12H18O/c13-11-7-3-6-10-8-4-1-2-5-9(8)12(10)11/h8-10,12H,1-7H2 |
| InChIKey | VLDNFRDVUXXAFG-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |