About 4-imino-5-methyl-2-propan-2-ylcyclohexa-2,5-dien-1-one
4-imino-5-methyl-2-propan-2-ylcyclohexa-2,5-dien-1-one (PubChem CID 130030077) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is 4-imino-5-methyl-2-propan-2-ylcyclohexa-2,5-dien-1-one.
Molecular Properties
| Compound Name | 4-imino-5-methyl-2-propan-2-ylcyclohexa-2,5-dien-1-one |
| PubChem CID | 130030077 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 4-imino-5-methyl-2-propan-2-ylcyclohexa-2,5-dien-1-one |
| SMILES | [H]/N=C1\C=C(C(C)C)C(=O)C=C1C |
| InChI | InChI=1S/C10H13NO/c1-6(2)8-5-9(11)7(3)4-10(8)12/h4-6,11H,1-3H3/b11-9+ |
| InChIKey | FSQMAXOKPYJUIN-PKNBQFBNSA-N |
| XLogP | 2.12 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-imino-5-methyl-2-propan-2-ylcyclohexa-2,5-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-imino-5-methyl-2-propan-2-ylcyclohexa-2,5-dien-1-one?
The IUPAC name of 4-imino-5-methyl-2-propan-2-ylcyclohexa-2,5-dien-1-one (CID 130030077) is 4-imino-5-methyl-2-propan-2-ylcyclohexa-2,5-dien-1-one.
What is the SMILES notation for 4-imino-5-methyl-2-propan-2-ylcyclohexa-2,5-dien-1-one?
The canonical SMILES for 4-imino-5-methyl-2-propan-2-ylcyclohexa-2,5-dien-1-one is [H]/N=C1\C=C(C(C)C)C(=O)C=C1C.
What is the InChIKey of 4-imino-5-methyl-2-propan-2-ylcyclohexa-2,5-dien-1-one?
The InChIKey is FSQMAXOKPYJUIN-PKNBQFBNSA-N. The full InChI is InChI=1S/C10H13NO/c1-6(2)8-5-9(11)7(3)4-10(8)12/h4-6,11H,1-3H3/b11-9+.
What are the key properties of 4-imino-5-methyl-2-propan-2-ylcyclohexa-2,5-dien-1-one?
4-imino-5-methyl-2-propan-2-ylcyclohexa-2,5-dien-1-one has a molecular weight of 163.22 g/mol, XLogP of 2.12, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-imino-5-methyl-2-propan-2-ylcyclohexa-2,5-dien-1-one is sourced from PubChem (CID 130030077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).