About 8-ethoxybicyclo[4.2.0]octa-1,3,5-trien-7-one
8-ethoxybicyclo[4.2.0]octa-1,3,5-trien-7-one (PubChem CID 130030444) has the molecular formula C10H10O2
and a molecular weight of 162.19 g/mol. Its IUPAC name is 8-ethoxybicyclo[4.2.0]octa-1,3,5-trien-7-one.
Molecular Properties
| Compound Name | 8-ethoxybicyclo[4.2.0]octa-1,3,5-trien-7-one |
| PubChem CID | 130030444 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | 8-ethoxybicyclo[4.2.0]octa-1,3,5-trien-7-one |
| SMILES | CCOC1C(=O)c2ccccc21 |
| InChI | InChI=1S/C10H10O2/c1-2-12-10-8-6-4-3-5-7(8)9(10)11/h3-6,10H,2H2,1H3 |
| InChIKey | UPLNQQFPHPZHFS-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-ethoxybicyclo[4.2.0]octa-1,3,5-trien-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-ethoxybicyclo[4.2.0]octa-1,3,5-trien-7-one?
The IUPAC name of 8-ethoxybicyclo[4.2.0]octa-1,3,5-trien-7-one (CID 130030444) is 8-ethoxybicyclo[4.2.0]octa-1,3,5-trien-7-one.
What is the SMILES notation for 8-ethoxybicyclo[4.2.0]octa-1,3,5-trien-7-one?
The canonical SMILES for 8-ethoxybicyclo[4.2.0]octa-1,3,5-trien-7-one is CCOC1C(=O)c2ccccc21.
What is the InChIKey of 8-ethoxybicyclo[4.2.0]octa-1,3,5-trien-7-one?
The InChIKey is UPLNQQFPHPZHFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O2/c1-2-12-10-8-6-4-3-5-7(8)9(10)11/h3-6,10H,2H2,1H3.
What are the key properties of 8-ethoxybicyclo[4.2.0]octa-1,3,5-trien-7-one?
8-ethoxybicyclo[4.2.0]octa-1,3,5-trien-7-one has a molecular weight of 162.19 g/mol, XLogP of 1.96, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-ethoxybicyclo[4.2.0]octa-1,3,5-trien-7-one is sourced from PubChem (CID 130030444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).