About 3-hydroxy-3-propa-1,2-dienylcyclohexan-1-one
3-hydroxy-3-propa-1,2-dienylcyclohexan-1-one (PubChem CID 130030563) has the molecular formula C9H12O2
and a molecular weight of 152.19 g/mol. Its IUPAC name is 3-hydroxy-3-propa-1,2-dienylcyclohexan-1-one.
Molecular Properties
| Compound Name | 3-hydroxy-3-propa-1,2-dienylcyclohexan-1-one |
| PubChem CID | 130030563 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 3-hydroxy-3-propa-1,2-dienylcyclohexan-1-one |
| SMILES | C=C=CC1(O)CCCC(=O)C1 |
| InChI | InChI=1S/C9H12O2/c1-2-5-9(11)6-3-4-8(10)7-9/h5,11H,1,3-4,6-7H2 |
| InChIKey | IGRMUKPIGJAPMQ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-hydroxy-3-propa-1,2-dienylcyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-3-propa-1,2-dienylcyclohexan-1-one?
The IUPAC name of 3-hydroxy-3-propa-1,2-dienylcyclohexan-1-one (CID 130030563) is 3-hydroxy-3-propa-1,2-dienylcyclohexan-1-one.
What is the SMILES notation for 3-hydroxy-3-propa-1,2-dienylcyclohexan-1-one?
The canonical SMILES for 3-hydroxy-3-propa-1,2-dienylcyclohexan-1-one is C=C=CC1(O)CCCC(=O)C1.
What is the InChIKey of 3-hydroxy-3-propa-1,2-dienylcyclohexan-1-one?
The InChIKey is IGRMUKPIGJAPMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O2/c1-2-5-9(11)6-3-4-8(10)7-9/h5,11H,1,3-4,6-7H2.
What are the key properties of 3-hydroxy-3-propa-1,2-dienylcyclohexan-1-one?
3-hydroxy-3-propa-1,2-dienylcyclohexan-1-one has a molecular weight of 152.19 g/mol, XLogP of 1.20, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-3-propa-1,2-dienylcyclohexan-1-one is sourced from PubChem (CID 130030563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).