About 3-(8-oxo-7-bicyclo[4.2.0]octa-1,3,5-trienyl)propanenitrile
3-(8-oxo-7-bicyclo[4.2.0]octa-1,3,5-trienyl)propanenitrile (PubChem CID 130030624) has the molecular formula C11H9NO
and a molecular weight of 171.20 g/mol. Its IUPAC name is 3-(8-oxo-7-bicyclo[4.2.0]octa-1,3,5-trienyl)propanenitrile.
Molecular Properties
| Compound Name | 3-(8-oxo-7-bicyclo[4.2.0]octa-1,3,5-trienyl)propanenitrile |
| PubChem CID | 130030624 |
| Molecular Formula | C11H9NO |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | 3-(8-oxo-7-bicyclo[4.2.0]octa-1,3,5-trienyl)propanenitrile |
| SMILES | N#CCCC1C(=O)c2ccccc21 |
| InChI | InChI=1S/C11H9NO/c12-7-3-6-10-8-4-1-2-5-9(8)11(10)13/h1-2,4-5,10H,3,6H2 |
| InChIKey | MSIQXQXNSFTOKG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(8-oxo-7-bicyclo[4.2.0]octa-1,3,5-trienyl)propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(8-oxo-7-bicyclo[4.2.0]octa-1,3,5-trienyl)propanenitrile?
The IUPAC name of 3-(8-oxo-7-bicyclo[4.2.0]octa-1,3,5-trienyl)propanenitrile (CID 130030624) is 3-(8-oxo-7-bicyclo[4.2.0]octa-1,3,5-trienyl)propanenitrile.
What is the SMILES notation for 3-(8-oxo-7-bicyclo[4.2.0]octa-1,3,5-trienyl)propanenitrile?
The canonical SMILES for 3-(8-oxo-7-bicyclo[4.2.0]octa-1,3,5-trienyl)propanenitrile is N#CCCC1C(=O)c2ccccc21.
What is the InChIKey of 3-(8-oxo-7-bicyclo[4.2.0]octa-1,3,5-trienyl)propanenitrile?
The InChIKey is MSIQXQXNSFTOKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO/c12-7-3-6-10-8-4-1-2-5-9(8)11(10)13/h1-2,4-5,10H,3,6H2.
What are the key properties of 3-(8-oxo-7-bicyclo[4.2.0]octa-1,3,5-trienyl)propanenitrile?
3-(8-oxo-7-bicyclo[4.2.0]octa-1,3,5-trienyl)propanenitrile has a molecular weight of 171.20 g/mol, XLogP of 2.27, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(8-oxo-7-bicyclo[4.2.0]octa-1,3,5-trienyl)propanenitrile is sourced from PubChem (CID 130030624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).