C11H12O3 — CID 130032721
3-prop-2-enyl-2H-1-benzofuran-3,6-diol (PubChem CID 130032721) has the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. Its IUPAC name is 3-prop-2-enyl-2H-1-benzofuran-3,6-diol.
| Compound Name | 3-prop-2-enyl-2H-1-benzofuran-3,6-diol |
|---|---|
| PubChem CID | 130032721 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 3-prop-2-enyl-2H-1-benzofuran-3,6-diol |
| SMILES | C=CCC1(O)COc2cc(O)ccc21 |
| InChI | InChI=1S/C11H12O3/c1-2-5-11(13)7-14-10-6-8(12)3-4-9(10)11/h2-4,6,12-13H,1,5,7H2 |
| InChIKey | ISCVDTCVMQZBQJ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|